C29H31N4O3+ — CID 91251440
[4-(3,5-dimethoxyphenyl)piperazin-1-yl]-(1-methyl-4-phenyl-1-pyridin-3-ylpyrrol-1-ium-3-yl)methanone (PubChem CID 91251440) has the molecular formula C29H31N4O3+ and a molecular weight of 483.59 g/mol. Its IUPAC name is [4-(3,5-dimethoxyphenyl)piperazin-1-yl]-(1-methyl-4-phenyl-1-pyridin-3-ylpyrrol-1-ium-3-yl)methanone.
| Compound Name | [4-(3,5-dimethoxyphenyl)piperazin-1-yl]-(1-methyl-4-phenyl-1-pyridin-3-ylpyrrol-1-ium-3-yl)methanone |
|---|---|
| PubChem CID | 91251440 |
| Molecular Formula | C29H31N4O3+ |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | [4-(3,5-dimethoxyphenyl)piperazin-1-yl]-(1-methyl-4-phenyl-1-pyridin-3-ylpyrrol-1-ium-3-yl)methanone |
| SMILES | COc1cc(OC)cc(N2CCN(C(=O)C3=C[N+](C)(c4cccnc4)C=C3c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C29H31N4O3/c1-33(24-10-7-11-30-19-24)20-27(22-8-5-4-6-9-22)28(21-33)29(34)32-14-12-31(13-15-32)23-16-25(35-2)18-26(17-23)36-3/h4-11,16-21H,12-15H2,1-3H3/q+1 |
| InChIKey | FGNAUDYCNLCFDH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|