C11H9F3N2S — CID 91251555
4-cyclopropyl-5-(trifluoromethyl)-1,2,4-benzothiadiazine (PubChem CID 91251555) has the molecular formula C11H9F3N2S and a molecular weight of 258.27 g/mol. Its IUPAC name is 4-cyclopropyl-5-(trifluoromethyl)-1,2,4-benzothiadiazine.
| Compound Name | 4-cyclopropyl-5-(trifluoromethyl)-1,2,4-benzothiadiazine |
|---|---|
| PubChem CID | 91251555 |
| Molecular Formula | C11H9F3N2S |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 4-cyclopropyl-5-(trifluoromethyl)-1,2,4-benzothiadiazine |
| SMILES | FC(F)(F)c1cccc2c1N(C1CC1)C=NS2 |
| InChI | InChI=1S/C11H9F3N2S/c12-11(13,14)8-2-1-3-9-10(8)16(6-15-17-9)7-4-5-7/h1-3,6-7H,4-5H2 |
| InChIKey | ZSXXOJUOKDRKLD-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|