C10H9F3N2O2 — CID 53253769
(3S)-3-amino-1-hydroxy-8-(trifluoromethyl)-3,4-dihydroquinolin-2-one (PubChem CID 53253769) has the molecular formula C10H9F3N2O2 and a molecular weight of 246.19 g/mol. Its IUPAC name is (3S)-3-amino-1-hydroxy-8-(trifluoromethyl)-3,4-dihydroquinolin-2-one.
| Compound Name | (3S)-3-amino-1-hydroxy-8-(trifluoromethyl)-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 53253769 |
| Molecular Formula | C10H9F3N2O2 |
| Molecular Weight | 246.19 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | (3S)-3-amino-1-hydroxy-8-(trifluoromethyl)-3,4-dihydroquinolin-2-one |
| SMILES | N[C@H]1Cc2cccc(C(F)(F)F)c2N(O)C1=O |
| InChI | InChI=1S/C10H9F3N2O2/c11-10(12,13)6-3-1-2-5-4-7(14)9(16)15(17)8(5)6/h1-3,7,17H,4,14H2/t7-/m0/s1 |
| InChIKey | GUPFBAXEAKMYBJ-ZETCQYMHSA-N |
| XLogP | 1.31 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.19 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|