C16H12F4N2O3 — CID 68782877
(3S)-3-amino-6-[4-fluoro-3-(trifluoromethyl)phenoxy]-1-hydroxy-3,4-dihydroquinolin-2-one (PubChem CID 68782877) has the molecular formula C16H12F4N2O3 and a molecular weight of 356.28 g/mol. Its IUPAC name is (3S)-3-amino-6-[4-fluoro-3-(trifluoromethyl)phenoxy]-1-hydroxy-3,4-dihydroquinolin-2-one.
| Compound Name | (3S)-3-amino-6-[4-fluoro-3-(trifluoromethyl)phenoxy]-1-hydroxy-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 68782877 |
| Molecular Formula | C16H12F4N2O3 |
| Molecular Weight | 356.28 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | (3S)-3-amino-6-[4-fluoro-3-(trifluoromethyl)phenoxy]-1-hydroxy-3,4-dihydroquinolin-2-one |
| SMILES | N[C@H]1Cc2cc(Oc3ccc(F)c(C(F)(F)F)c3)ccc2N(O)C1=O |
| InChI | InChI=1S/C16H12F4N2O3/c17-12-3-1-10(7-11(12)16(18,19)20)25-9-2-4-14-8(5-9)6-13(21)15(23)22(14)24/h1-5,7,13,24H,6,21H2/t13-/m0/s1 |
| InChIKey | GOGUYJQCDBXONF-ZDUSSCGKSA-N |
| XLogP | 3.24 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|