About 3-amino-7-(2,5-difluorophenyl)-1-hydroxy-3,4-dihydroquinolin-2-one
3-amino-7-(2,5-difluorophenyl)-1-hydroxy-3,4-dihydroquinolin-2-one (PubChem CID 91256684) has the molecular formula C15H12F2N2O2
and a molecular weight of 290.27 g/mol. Its IUPAC name is 3-amino-7-(2,5-difluorophenyl)-1-hydroxy-3,4-dihydroquinolin-2-one.
Molecular Properties
| Compound Name | 3-amino-7-(2,5-difluorophenyl)-1-hydroxy-3,4-dihydroquinolin-2-one |
| PubChem CID | 91256684 |
| Molecular Formula | C15H12F2N2O2 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 3-amino-7-(2,5-difluorophenyl)-1-hydroxy-3,4-dihydroquinolin-2-one |
| SMILES | NC1Cc2ccc(-c3cc(F)ccc3F)cc2N(O)C1=O |
| InChI | InChI=1S/C15H12F2N2O2/c16-10-3-4-12(17)11(7-10)8-1-2-9-5-13(18)15(20)19(21)14(9)6-8/h1-4,6-7,13,21H,5,18H2 |
| InChIKey | KQZPUUWYQIVJAI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-7-(2,5-difluorophenyl)-1-hydroxy-3,4-dihydroquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-7-(2,5-difluorophenyl)-1-hydroxy-3,4-dihydroquinolin-2-one?
The IUPAC name of 3-amino-7-(2,5-difluorophenyl)-1-hydroxy-3,4-dihydroquinolin-2-one (CID 91256684) is 3-amino-7-(2,5-difluorophenyl)-1-hydroxy-3,4-dihydroquinolin-2-one.
What is the SMILES notation for 3-amino-7-(2,5-difluorophenyl)-1-hydroxy-3,4-dihydroquinolin-2-one?
The canonical SMILES for 3-amino-7-(2,5-difluorophenyl)-1-hydroxy-3,4-dihydroquinolin-2-one is NC1Cc2ccc(-c3cc(F)ccc3F)cc2N(O)C1=O.
What is the InChIKey of 3-amino-7-(2,5-difluorophenyl)-1-hydroxy-3,4-dihydroquinolin-2-one?
The InChIKey is KQZPUUWYQIVJAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F2N2O2/c16-10-3-4-12(17)11(7-10)8-1-2-9-5-13(18)15(20)19(21)14(9)6-8/h1-4,6-7,13,21H,5,18H2.
What are the key properties of 3-amino-7-(2,5-difluorophenyl)-1-hydroxy-3,4-dihydroquinolin-2-one?
3-amino-7-(2,5-difluorophenyl)-1-hydroxy-3,4-dihydroquinolin-2-one has a molecular weight of 290.27 g/mol, XLogP of 2.24, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-7-(2,5-difluorophenyl)-1-hydroxy-3,4-dihydroquinolin-2-one is sourced from PubChem (CID 91256684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).