C15H12F2N2O3 — CID 68781676
(3S)-3-amino-6-(2,5-difluorophenoxy)-1-hydroxy-3,4-dihydroquinolin-2-one (PubChem CID 68781676) has the molecular formula C15H12F2N2O3 and a molecular weight of 306.27 g/mol. Its IUPAC name is (3S)-3-amino-6-(2,5-difluorophenoxy)-1-hydroxy-3,4-dihydroquinolin-2-one.
| Compound Name | (3S)-3-amino-6-(2,5-difluorophenoxy)-1-hydroxy-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 68781676 |
| Molecular Formula | C15H12F2N2O3 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | (3S)-3-amino-6-(2,5-difluorophenoxy)-1-hydroxy-3,4-dihydroquinolin-2-one |
| SMILES | N[C@H]1Cc2cc(Oc3cc(F)ccc3F)ccc2N(O)C1=O |
| InChI | InChI=1S/C15H12F2N2O3/c16-9-1-3-11(17)14(7-9)22-10-2-4-13-8(5-10)6-12(18)15(20)19(13)21/h1-5,7,12,21H,6,18H2/t12-/m0/s1 |
| InChIKey | NJUDCGHPWUTYLB-LBPRGKRZSA-N |
| XLogP | 2.36 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|