C17H17F2N3O2 — CID 68784867
(3S)-3-amino-6-[(2,3-difluoro-N-methylanilino)methyl]-1-hydroxy-3,4-dihydroquinolin-2-one (PubChem CID 68784867) has the molecular formula C17H17F2N3O2 and a molecular weight of 333.34 g/mol. Its IUPAC name is (3S)-3-amino-6-[(2,3-difluoro-N-methylanilino)methyl]-1-hydroxy-3,4-dihydroquinolin-2-one.
| Compound Name | (3S)-3-amino-6-[(2,3-difluoro-N-methylanilino)methyl]-1-hydroxy-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 68784867 |
| Molecular Formula | C17H17F2N3O2 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | (3S)-3-amino-6-[(2,3-difluoro-N-methylanilino)methyl]-1-hydroxy-3,4-dihydroquinolin-2-one |
| SMILES | CN(Cc1ccc2c(c1)C[C@H](N)C(=O)N2O)c1cccc(F)c1F |
| InChI | InChI=1S/C17H17F2N3O2/c1-21(15-4-2-3-12(18)16(15)19)9-10-5-6-14-11(7-10)8-13(20)17(23)22(14)24/h2-7,13,24H,8-9,20H2,1H3/t13-/m0/s1 |
| InChIKey | RNHYLMPSLFVTHG-ZDUSSCGKSA-N |
| XLogP | 2.21 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|