C17H12F6N2O2 — CID 59627076
(3S)-3-amino-1-hydroxy-8-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-3,4-dihydroquinolin-2-one (PubChem CID 59627076) has the molecular formula C17H12F6N2O2 and a molecular weight of 390.28 g/mol. Its IUPAC name is (3S)-3-amino-1-hydroxy-8-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-3,4-dihydroquinolin-2-one.
| Compound Name | (3S)-3-amino-1-hydroxy-8-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 59627076 |
| Molecular Formula | C17H12F6N2O2 |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | (3S)-3-amino-1-hydroxy-8-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-3,4-dihydroquinolin-2-one |
| SMILES | N[C@H]1Cc2cc(-c3ccc(C(F)(F)F)cc3)cc(C(F)(F)F)c2N(O)C1=O |
| InChI | InChI=1S/C17H12F6N2O2/c18-16(19,20)11-3-1-8(2-4-11)9-5-10-7-13(24)15(26)25(27)14(10)12(6-9)17(21,22)23/h1-6,13,27H,7,24H2/t13-/m0/s1 |
| InChIKey | KJMNHAZSGJYXPF-ZDUSSCGKSA-N |
| XLogP | 4.00 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|