C12H25NO4 — CID 91251756
2,3-dihydroxypropyl 2-(butan-2-ylamino)-2-methylbutanoate (PubChem CID 91251756) has the molecular formula C12H25NO4 and a molecular weight of 247.33 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 2-(butan-2-ylamino)-2-methylbutanoate.
| Compound Name | 2,3-dihydroxypropyl 2-(butan-2-ylamino)-2-methylbutanoate |
|---|---|
| PubChem CID | 91251756 |
| Molecular Formula | C12H25NO4 |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | 2,3-dihydroxypropyl 2-(butan-2-ylamino)-2-methylbutanoate |
| SMILES | CCC(C)NC(C)(CC)C(=O)OCC(O)CO |
| InChI | InChI=1S/C12H25NO4/c1-5-9(3)13-12(4,6-2)11(16)17-8-10(15)7-14/h9-10,13-15H,5-8H2,1-4H3 |
| InChIKey | QMNAWTCJHIOTEJ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |