About 2,3-dihydroxypropyl 2-(butan-2-ylamino)-2-methylbutanoate
2,3-dihydroxypropyl 2-(butan-2-ylamino)-2-methylbutanoate (PubChem CID 91251756) has the molecular formula C12H25NO4
and a molecular weight of 247.33 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 2-(butan-2-ylamino)-2-methylbutanoate.
Molecular Properties
| Compound Name | 2,3-dihydroxypropyl 2-(butan-2-ylamino)-2-methylbutanoate |
| PubChem CID | 91251756 |
| Molecular Formula | C12H25NO4 |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | 2,3-dihydroxypropyl 2-(butan-2-ylamino)-2-methylbutanoate |
| SMILES | CCC(C)NC(C)(CC)C(=O)OCC(O)CO |
| InChI | InChI=1S/C12H25NO4/c1-5-9(3)13-12(4,6-2)11(16)17-8-10(15)7-14/h9-10,13-15H,5-8H2,1-4H3 |
| InChIKey | QMNAWTCJHIOTEJ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,3-dihydroxypropyl 2-(butan-2-ylamino)-2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxypropyl 2-(butan-2-ylamino)-2-methylbutanoate?
The IUPAC name of 2,3-dihydroxypropyl 2-(butan-2-ylamino)-2-methylbutanoate (CID 91251756) is 2,3-dihydroxypropyl 2-(butan-2-ylamino)-2-methylbutanoate.
What is the SMILES notation for 2,3-dihydroxypropyl 2-(butan-2-ylamino)-2-methylbutanoate?
The canonical SMILES for 2,3-dihydroxypropyl 2-(butan-2-ylamino)-2-methylbutanoate is CCC(C)NC(C)(CC)C(=O)OCC(O)CO.
What is the InChIKey of 2,3-dihydroxypropyl 2-(butan-2-ylamino)-2-methylbutanoate?
The InChIKey is QMNAWTCJHIOTEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO4/c1-5-9(3)13-12(4,6-2)11(16)17-8-10(15)7-14/h9-10,13-15H,5-8H2,1-4H3.
What are the key properties of 2,3-dihydroxypropyl 2-(butan-2-ylamino)-2-methylbutanoate?
2,3-dihydroxypropyl 2-(butan-2-ylamino)-2-methylbutanoate has a molecular weight of 247.33 g/mol, XLogP of 0.44, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxypropyl 2-(butan-2-ylamino)-2-methylbutanoate is sourced from PubChem (CID 91251756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).