C11H5Cl5N2 — CID 91252830
2,3,5,6-tetrachloro-N-(4-chlorophenyl)pyridin-4-amine (PubChem CID 91252830) has the molecular formula C11H5Cl5N2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 2,3,5,6-tetrachloro-N-(4-chlorophenyl)pyridin-4-amine.
| Compound Name | 2,3,5,6-tetrachloro-N-(4-chlorophenyl)pyridin-4-amine |
|---|---|
| PubChem CID | 91252830 |
| Molecular Formula | C11H5Cl5N2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 339.89 |
| IUPAC Name | 2,3,5,6-tetrachloro-N-(4-chlorophenyl)pyridin-4-amine |
| SMILES | Clc1ccc(Nc2c(Cl)c(Cl)nc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C11H5Cl5N2/c12-5-1-3-6(4-2-5)17-9-7(13)10(15)18-11(16)8(9)14/h1-4H,(H,17,18) |
| InChIKey | UYEANUFNROPMDU-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|