C14H13F3N2OS — CID 91253125
2-[3-[2-(trifluoromethyl)phenoxy]pyrrolidin-1-yl]-1,3-thiazole (PubChem CID 91253125) has the molecular formula C14H13F3N2OS and a molecular weight of 314.33 g/mol. Its IUPAC name is 2-[3-[2-(trifluoromethyl)phenoxy]pyrrolidin-1-yl]-1,3-thiazole.
| Compound Name | 2-[3-[2-(trifluoromethyl)phenoxy]pyrrolidin-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 91253125 |
| Molecular Formula | C14H13F3N2OS |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 2-[3-[2-(trifluoromethyl)phenoxy]pyrrolidin-1-yl]-1,3-thiazole |
| SMILES | FC(F)(F)c1ccccc1OC1CCN(c2nccs2)C1 |
| InChI | InChI=1S/C14H13F3N2OS/c15-14(16,17)11-3-1-2-4-12(11)20-10-5-7-19(9-10)13-18-6-8-21-13/h1-4,6,8,10H,5,7,9H2 |
| InChIKey | BWJGRZLDHHFUGU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |