C20H35NS — CID 91253982
3-[3-(3-cyclohexylpropylsulfanyl)cyclohexa-2,4-dien-1-yl]pentan-1-amine (PubChem CID 91253982) has the molecular formula C20H35NS and a molecular weight of 321.57 g/mol. Its IUPAC name is 3-[3-(3-cyclohexylpropylsulfanyl)cyclohexa-2,4-dien-1-yl]pentan-1-amine.
| Compound Name | 3-[3-(3-cyclohexylpropylsulfanyl)cyclohexa-2,4-dien-1-yl]pentan-1-amine |
|---|---|
| PubChem CID | 91253982 |
| Molecular Formula | C20H35NS |
| Molecular Weight | 321.57 g/mol |
| Exact Mass | 321.25 |
| IUPAC Name | 3-[3-(3-cyclohexylpropylsulfanyl)cyclohexa-2,4-dien-1-yl]pentan-1-amine |
| SMILES | CCC(CCN)C1C=C(SCCCC2CCCCC2)C=CC1 |
| InChI | InChI=1S/C20H35NS/c1-2-18(13-14-21)19-11-6-12-20(16-19)22-15-7-10-17-8-4-3-5-9-17/h6,12,16-19H,2-5,7-11,13-15,21H2,1H3 |
| InChIKey | PGEWAKHEPZKJKT-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.57 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|