C26H36ClN4O7+ — CID 91254487
2-[[1-[(2S)-2-[[2-chloro-4-(2-methylpropanoylamino)benzoyl]amino]-3,3-dimethylbutanoyl]pyrrolidin-1-ium-1-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 91254487) has the molecular formula C26H36ClN4O7+ and a molecular weight of 552.05 g/mol. Its IUPAC name is 2-[[1-[(2S)-2-[[2-chloro-4-(2-methylpropanoylamino)benzoyl]amino]-3,3-dimethylbutanoyl]pyrrolidin-1-ium-1-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | 2-[[1-[(2S)-2-[[2-chloro-4-(2-methylpropanoylamino)benzoyl]amino]-3,3-dimethylbutanoyl]pyrrolidin-1-ium-1-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 91254487 |
| Molecular Formula | C26H36ClN4O7+ |
| Molecular Weight | 552.05 g/mol |
| Exact Mass | 551.23 |
| IUPAC Name | 2-[[1-[(2S)-2-[[2-chloro-4-(2-methylpropanoylamino)benzoyl]amino]-3,3-dimethylbutanoyl]pyrrolidin-1-ium-1-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | CC(C)C(=O)Nc1ccc(C(=O)N[C@H](C(=O)[N+]2(C(=O)NC(CC=O)C(=O)O)CCCC2)C(C)(C)C)c(Cl)c1 |
| InChI | InChI=1S/C26H35ClN4O7/c1-15(2)21(33)28-16-8-9-17(18(27)14-16)22(34)30-20(26(3,4)5)23(35)31(11-6-7-12-31)25(38)29-19(10-13-32)24(36)37/h8-9,13-15,19-20H,6-7,10-12H2,1-5H3,(H3-,28,29,30,33,34,36,37,38)/p+1/t19?,20-/m1/s1 |
| InChIKey | GCXHADGHWPMTLN-GFOWMXPYSA-O |
| XLogP | 2.97 |
| TPSA | 158.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.05 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|