C20H29N5O2 — CID 9125498
4-[[[2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-oxoethyl]-methylamino]methyl]-N-methylbenzamide (PubChem CID 9125498) has the molecular formula C20H29N5O2 and a molecular weight of 371.49 g/mol. Its IUPAC name is 4-[[[2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-oxoethyl]-methylamino]methyl]-N-methylbenzamide.
| Compound Name | 4-[[[2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-oxoethyl]-methylamino]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 9125498 |
| Molecular Formula | C20H29N5O2 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | 4-[[[2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-oxoethyl]-methylamino]methyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(CN(C)CC(=O)NCCCn2nc(C)cc2C)cc1 |
| InChI | InChI=1S/C20H29N5O2/c1-15-12-16(2)25(23-15)11-5-10-22-19(26)14-24(4)13-17-6-8-18(9-7-17)20(27)21-3/h6-9,12H,5,10-11,13-14H2,1-4H3,(H,21,27)(H,22,26) |
| InChIKey | FXKRLESOWXKRNH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|