C20H29N5O2S — CID 8814267
N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-[methyl-[2-(2-methylsulfanylanilino)-2-oxoethyl]amino]acetamide (PubChem CID 8814267) has the molecular formula C20H29N5O2S and a molecular weight of 403.55 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-[methyl-[2-(2-methylsulfanylanilino)-2-oxoethyl]amino]acetamide.
| Compound Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-[methyl-[2-(2-methylsulfanylanilino)-2-oxoethyl]amino]acetamide |
|---|---|
| PubChem CID | 8814267 |
| Molecular Formula | C20H29N5O2S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-[methyl-[2-(2-methylsulfanylanilino)-2-oxoethyl]amino]acetamide |
| SMILES | CSc1ccccc1NC(=O)CN(C)CC(=O)NCCCn1nc(C)cc1C |
| InChI | InChI=1S/C20H29N5O2S/c1-15-12-16(2)25(23-15)11-7-10-21-19(26)13-24(3)14-20(27)22-17-8-5-6-9-18(17)28-4/h5-6,8-9,12H,7,10-11,13-14H2,1-4H3,(H,21,26)(H,22,27) |
| InChIKey | FJVQHHWWHPKTBS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|