C19H29N5O3S — CID 47011067
N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-[methyl-[1-(4-sulfamoylphenyl)ethyl]amino]acetamide (PubChem CID 47011067) has the molecular formula C19H29N5O3S and a molecular weight of 407.54 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-[methyl-[1-(4-sulfamoylphenyl)ethyl]amino]acetamide.
| Compound Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-[methyl-[1-(4-sulfamoylphenyl)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 47011067 |
| Molecular Formula | C19H29N5O3S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-[methyl-[1-(4-sulfamoylphenyl)ethyl]amino]acetamide |
| SMILES | Cc1cc(C)n(CCCNC(=O)CN(C)C(C)c2ccc(S(N)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C19H29N5O3S/c1-14-12-15(2)24(22-14)11-5-10-21-19(25)13-23(4)16(3)17-6-8-18(9-7-17)28(20,26)27/h6-9,12,16H,5,10-11,13H2,1-4H3,(H,21,25)(H2,20,26,27) |
| InChIKey | QCVVTJDLZDSKOL-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|