C17H23N3O3S2 — CID 47010656
2-[methyl-[1-(4-sulfamoylphenyl)ethyl]amino]-N-(2-thiophen-2-ylethyl)acetamide (PubChem CID 47010656) has the molecular formula C17H23N3O3S2 and a molecular weight of 381.52 g/mol. Its IUPAC name is 2-[methyl-[1-(4-sulfamoylphenyl)ethyl]amino]-N-(2-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-[methyl-[1-(4-sulfamoylphenyl)ethyl]amino]-N-(2-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 47010656 |
| Molecular Formula | C17H23N3O3S2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 2-[methyl-[1-(4-sulfamoylphenyl)ethyl]amino]-N-(2-thiophen-2-ylethyl)acetamide |
| SMILES | CC(c1ccc(S(N)(=O)=O)cc1)N(C)CC(=O)NCCc1cccs1 |
| InChI | InChI=1S/C17H23N3O3S2/c1-13(14-5-7-16(8-6-14)25(18,22)23)20(2)12-17(21)19-10-9-15-4-3-11-24-15/h3-8,11,13H,9-10,12H2,1-2H3,(H,19,21)(H2,18,22,23) |
| InChIKey | JPGUGHKTENMPCG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |