C17H24N2O4S2 — CID 78827659
4-[1-[[2-hydroxy-3-(thiophen-2-ylmethoxy)propyl]-methylamino]ethyl]benzenesulfonamide (PubChem CID 78827659) has the molecular formula C17H24N2O4S2 and a molecular weight of 384.52 g/mol. Its IUPAC name is 4-[1-[[2-hydroxy-3-(thiophen-2-ylmethoxy)propyl]-methylamino]ethyl]benzenesulfonamide.
| Compound Name | 4-[1-[[2-hydroxy-3-(thiophen-2-ylmethoxy)propyl]-methylamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 78827659 |
| Molecular Formula | C17H24N2O4S2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 4-[1-[[2-hydroxy-3-(thiophen-2-ylmethoxy)propyl]-methylamino]ethyl]benzenesulfonamide |
| SMILES | CC(c1ccc(S(N)(=O)=O)cc1)N(C)CC(O)COCc1cccs1 |
| InChI | InChI=1S/C17H24N2O4S2/c1-13(14-5-7-17(8-6-14)25(18,21)22)19(2)10-15(20)11-23-12-16-4-3-9-24-16/h3-9,13,15,20H,10-12H2,1-2H3,(H2,18,21,22) |
| InChIKey | NZBHDDNBMAVSND-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |