C30H39N3O4 — CID 91255942
3-(cyclopropylmethyl)-N'-[(3S)-2-oxo-1-[(3-phenoxyphenyl)methyl]azepan-3-yl]-2-propylbutanediamide (PubChem CID 91255942) has the molecular formula C30H39N3O4 and a molecular weight of 505.66 g/mol. Its IUPAC name is 3-(cyclopropylmethyl)-N'-[(3S)-2-oxo-1-[(3-phenoxyphenyl)methyl]azepan-3-yl]-2-propylbutanediamide.
| Compound Name | 3-(cyclopropylmethyl)-N'-[(3S)-2-oxo-1-[(3-phenoxyphenyl)methyl]azepan-3-yl]-2-propylbutanediamide |
|---|---|
| PubChem CID | 91255942 |
| Molecular Formula | C30H39N3O4 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | 3-(cyclopropylmethyl)-N'-[(3S)-2-oxo-1-[(3-phenoxyphenyl)methyl]azepan-3-yl]-2-propylbutanediamide |
| SMILES | CCCC(C(N)=O)C(CC1CC1)C(=O)N[C@H]1CCCCN(Cc2cccc(Oc3ccccc3)c2)C1=O |
| InChI | InChI=1S/C30H39N3O4/c1-2-9-25(28(31)34)26(19-21-15-16-21)29(35)32-27-14-6-7-17-33(30(27)36)20-22-10-8-13-24(18-22)37-23-11-4-3-5-12-23/h3-5,8,10-13,18,21,25-27H,2,6-7,9,14-17,19-20H2,1H3,(H2,31,34)(H,32,35)/t25?,26?,27-/m0/s1 |
| InChIKey | XXZYPIOGLIRGJI-RCSZBHJWSA-N |
| XLogP | 4.79 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |