C32H41N3O4 — CID 91456785
3-(cyclobutylmethyl)-N'-[(3S)-1-[[3-(4-methoxyphenyl)phenyl]methyl]-2-oxoazepan-3-yl]-2-prop-2-enylbutanediamide (PubChem CID 91456785) has the molecular formula C32H41N3O4 and a molecular weight of 531.70 g/mol. Its IUPAC name is 3-(cyclobutylmethyl)-N'-[(3S)-1-[[3-(4-methoxyphenyl)phenyl]methyl]-2-oxoazepan-3-yl]-2-prop-2-enylbutanediamide.
| Compound Name | 3-(cyclobutylmethyl)-N'-[(3S)-1-[[3-(4-methoxyphenyl)phenyl]methyl]-2-oxoazepan-3-yl]-2-prop-2-enylbutanediamide |
|---|---|
| PubChem CID | 91456785 |
| Molecular Formula | C32H41N3O4 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.31 |
| IUPAC Name | 3-(cyclobutylmethyl)-N'-[(3S)-1-[[3-(4-methoxyphenyl)phenyl]methyl]-2-oxoazepan-3-yl]-2-prop-2-enylbutanediamide |
| SMILES | C=CCC(C(N)=O)C(CC1CCC1)C(=O)N[C@H]1CCCCN(Cc2cccc(-c3ccc(OC)cc3)c2)C1=O |
| InChI | InChI=1S/C32H41N3O4/c1-3-8-27(30(33)36)28(20-22-9-6-10-22)31(37)34-29-13-4-5-18-35(32(29)38)21-23-11-7-12-25(19-23)24-14-16-26(39-2)17-15-24/h3,7,11-12,14-17,19,22,27-29H,1,4-6,8-10,13,18,20-21H2,2H3,(H2,33,36)(H,34,37)/t27?,28?,29-/m0/s1 |
| InChIKey | ZDCZOBRPBNBEBK-PPUMFKDSSA-N |
| XLogP | 4.84 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|