C31H39N3O4 — CID 91491146
3-(cyclobutylmethyl)-N'-[(3S)-2-oxo-1-[(3-phenoxyphenyl)methyl]azepan-3-yl]-2-prop-2-enylbutanediamide (PubChem CID 91491146) has the molecular formula C31H39N3O4 and a molecular weight of 517.67 g/mol. Its IUPAC name is 3-(cyclobutylmethyl)-N'-[(3S)-2-oxo-1-[(3-phenoxyphenyl)methyl]azepan-3-yl]-2-prop-2-enylbutanediamide.
| Compound Name | 3-(cyclobutylmethyl)-N'-[(3S)-2-oxo-1-[(3-phenoxyphenyl)methyl]azepan-3-yl]-2-prop-2-enylbutanediamide |
|---|---|
| PubChem CID | 91491146 |
| Molecular Formula | C31H39N3O4 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.29 |
| IUPAC Name | 3-(cyclobutylmethyl)-N'-[(3S)-2-oxo-1-[(3-phenoxyphenyl)methyl]azepan-3-yl]-2-prop-2-enylbutanediamide |
| SMILES | C=CCC(C(N)=O)C(CC1CCC1)C(=O)N[C@H]1CCCCN(Cc2cccc(Oc3ccccc3)c2)C1=O |
| InChI | InChI=1S/C31H39N3O4/c1-2-10-26(29(32)35)27(20-22-11-8-12-22)30(36)33-28-17-6-7-18-34(31(28)37)21-23-13-9-16-25(19-23)38-24-14-4-3-5-15-24/h2-5,9,13-16,19,22,26-28H,1,6-8,10-12,17-18,20-21H2,(H2,32,35)(H,33,36)/t26?,27?,28-/m0/s1 |
| InChIKey | WHXCLWFRHHKYBV-LADMEODRSA-N |
| XLogP | 4.96 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|