C11H10F3NO6S — CID 91256428
(10,12-dihydroxy-4-oxa-11-azatetracyclo[7.3.0.02,6.03,5]dodeca-1(12),9-dien-11-yl) trifluoromethanesulfonate (PubChem CID 91256428) has the molecular formula C11H10F3NO6S and a molecular weight of 341.26 g/mol. Its IUPAC name is (10,12-dihydroxy-4-oxa-11-azatetracyclo[7.3.0.02,6.03,5]dodeca-1(12),9-dien-11-yl) trifluoromethanesulfonate.
| Compound Name | (10,12-dihydroxy-4-oxa-11-azatetracyclo[7.3.0.02,6.03,5]dodeca-1(12),9-dien-11-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 91256428 |
| Molecular Formula | C11H10F3NO6S |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | (10,12-dihydroxy-4-oxa-11-azatetracyclo[7.3.0.02,6.03,5]dodeca-1(12),9-dien-11-yl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(On1c(O)c2c(c1O)C1C(CC2)C2OC21)C(F)(F)F |
| InChI | InChI=1S/C11H10F3NO6S/c12-11(13,14)22(18,19)21-15-9(16)4-2-1-3-5(6(4)10(15)17)8-7(3)20-8/h3,5,7-8,16-17H,1-2H2 |
| InChIKey | JQTIMPOPZBCGJQ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|