C15H14N4OS — CID 91257681
ethane;N-phenyl-7-oxa-5-thia-3,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),3,9,11-pentaen-9-amine (PubChem CID 91257681) has the molecular formula C15H14N4OS and a molecular weight of 298.37 g/mol. Its IUPAC name is ethane;N-phenyl-7-oxa-5-thia-3,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),3,9,11-pentaen-9-amine.
| Compound Name | ethane;N-phenyl-7-oxa-5-thia-3,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),3,9,11-pentaen-9-amine |
|---|---|
| PubChem CID | 91257681 |
| Molecular Formula | C15H14N4OS |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | ethane;N-phenyl-7-oxa-5-thia-3,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),3,9,11-pentaen-9-amine |
| SMILES | CC.c1ccc(Nc2ncnc3c2oc2scnc23)cc1 |
| InChI | InChI=1S/C13H8N4OS.C2H6/c1-2-4-8(5-3-1)17-12-11-9(14-6-15-12)10-13(18-11)19-7-16-10;1-2/h1-7H,(H,14,15,17);1-2H3 |
| InChIKey | HELIJSMQVSAYQM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |