C13H24F2N2O4 — CID 91258966
tert-butyl N-[(3S)-1-(dimethylamino)-2,2-difluoro-3-hydroxy-1-oxohexan-3-yl]carbamate (PubChem CID 91258966) has the molecular formula C13H24F2N2O4 and a molecular weight of 310.34 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-(dimethylamino)-2,2-difluoro-3-hydroxy-1-oxohexan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-(dimethylamino)-2,2-difluoro-3-hydroxy-1-oxohexan-3-yl]carbamate |
|---|---|
| PubChem CID | 91258966 |
| Molecular Formula | C13H24F2N2O4 |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | tert-butyl N-[(3S)-1-(dimethylamino)-2,2-difluoro-3-hydroxy-1-oxohexan-3-yl]carbamate |
| SMILES | CCC[C@@](O)(NC(=O)OC(C)(C)C)C(F)(F)C(=O)N(C)C |
| InChI | InChI=1S/C13H24F2N2O4/c1-7-8-12(20,13(14,15)9(18)17(5)6)16-10(19)21-11(2,3)4/h20H,7-8H2,1-6H3,(H,16,19)/t12-/m0/s1 |
| InChIKey | NYOGHPNCFYNIGZ-LBPRGKRZSA-N |
| XLogP | 1.72 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|