C25H30N2O2 — CID 91260282
4-amino-1-[3-(3-aminopropyl)phenyl]-6-[3-(3-methoxyprop-1-ynyl)phenyl]hex-1-yn-3-ol (PubChem CID 91260282) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 4-amino-1-[3-(3-aminopropyl)phenyl]-6-[3-(3-methoxyprop-1-ynyl)phenyl]hex-1-yn-3-ol.
| Compound Name | 4-amino-1-[3-(3-aminopropyl)phenyl]-6-[3-(3-methoxyprop-1-ynyl)phenyl]hex-1-yn-3-ol |
|---|---|
| PubChem CID | 91260282 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 4-amino-1-[3-(3-aminopropyl)phenyl]-6-[3-(3-methoxyprop-1-ynyl)phenyl]hex-1-yn-3-ol |
| SMILES | COCC#Cc1cccc(CCC(N)C(O)C#Cc2cccc(CCCN)c2)c1 |
| InChI | InChI=1S/C25H30N2O2/c1-29-17-5-11-21-7-3-8-22(19-21)12-14-24(27)25(28)15-13-23-9-2-6-20(18-23)10-4-16-26/h2-3,6-9,18-19,24-25,28H,4,10,12,14,16-17,26-27H2,1H3 |
| InChIKey | WDDIGUXOYKKPHD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|