C12H20N2O3 — CID 91261605
6-(2,5-dihydroxy-3-methylpyrrol-1-yl)-N-methylhexanamide (PubChem CID 91261605) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is 6-(2,5-dihydroxy-3-methylpyrrol-1-yl)-N-methylhexanamide.
| Compound Name | 6-(2,5-dihydroxy-3-methylpyrrol-1-yl)-N-methylhexanamide |
|---|---|
| PubChem CID | 91261605 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 6-(2,5-dihydroxy-3-methylpyrrol-1-yl)-N-methylhexanamide |
| SMILES | CNC(=O)CCCCCn1c(O)cc(C)c1O |
| InChI | InChI=1S/C12H20N2O3/c1-9-8-11(16)14(12(9)17)7-5-3-4-6-10(15)13-2/h8,16-17H,3-7H2,1-2H3,(H,13,15) |
| InChIKey | IKVHYOHJXUWDPY-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|