C21H28BrN3O — CID 91261904
4-(4-bromo-2,6-dimethylphenyl)-6-methyl-8-pentoxy-2,3-dihydro-1H-pyrido[2,3-b]pyrazine (PubChem CID 91261904) has the molecular formula C21H28BrN3O and a molecular weight of 418.38 g/mol. Its IUPAC name is 4-(4-bromo-2,6-dimethylphenyl)-6-methyl-8-pentoxy-2,3-dihydro-1H-pyrido[2,3-b]pyrazine.
| Compound Name | 4-(4-bromo-2,6-dimethylphenyl)-6-methyl-8-pentoxy-2,3-dihydro-1H-pyrido[2,3-b]pyrazine |
|---|---|
| PubChem CID | 91261904 |
| Molecular Formula | C21H28BrN3O |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 4-(4-bromo-2,6-dimethylphenyl)-6-methyl-8-pentoxy-2,3-dihydro-1H-pyrido[2,3-b]pyrazine |
| SMILES | CCCCCOc1cc(C)nc2c1NCCN2c1c(C)cc(Br)cc1C |
| InChI | InChI=1S/C21H28BrN3O/c1-5-6-7-10-26-18-13-16(4)24-21-19(18)23-8-9-25(21)20-14(2)11-17(22)12-15(20)3/h11-13,23H,5-10H2,1-4H3 |
| InChIKey | QRNRFZZXZVQQIE-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|