C21H26FN — CID 91262052
2-[4-(2-fluorobut-3-en-2-yl)phenyl]-5-methyl-4-methylidene-N-prop-2-enylhex-1-en-3-imine (PubChem CID 91262052) has the molecular formula C21H26FN and a molecular weight of 311.44 g/mol. Its IUPAC name is 2-[4-(2-fluorobut-3-en-2-yl)phenyl]-5-methyl-4-methylidene-N-prop-2-enylhex-1-en-3-imine.
| Compound Name | 2-[4-(2-fluorobut-3-en-2-yl)phenyl]-5-methyl-4-methylidene-N-prop-2-enylhex-1-en-3-imine |
|---|---|
| PubChem CID | 91262052 |
| Molecular Formula | C21H26FN |
| Molecular Weight | 311.44 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 2-[4-(2-fluorobut-3-en-2-yl)phenyl]-5-methyl-4-methylidene-N-prop-2-enylhex-1-en-3-imine |
| SMILES | C=CC/N=C(/C(=C)c1ccc(C(C)(F)C=C)cc1)C(=C)C(C)C |
| InChI | InChI=1S/C21H26FN/c1-8-14-23-20(16(5)15(3)4)17(6)18-10-12-19(13-11-18)21(7,22)9-2/h8-13,15H,1-2,5-6,14H2,3-4,7H3/b23-20+ |
| InChIKey | NTSMDWRABGBHTG-BSYVCWPDSA-N |
| XLogP | 5.91 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.44 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|