C17H28O2 — CID 91262679
5-(2,7,8-trimethyl-3,4,4a,7,8,8a-hexahydrochromen-2-yl)pentan-2-one (PubChem CID 91262679) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 5-(2,7,8-trimethyl-3,4,4a,7,8,8a-hexahydrochromen-2-yl)pentan-2-one.
| Compound Name | 5-(2,7,8-trimethyl-3,4,4a,7,8,8a-hexahydrochromen-2-yl)pentan-2-one |
|---|---|
| PubChem CID | 91262679 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 5-(2,7,8-trimethyl-3,4,4a,7,8,8a-hexahydrochromen-2-yl)pentan-2-one |
| SMILES | CC(=O)CCCC1(C)CCC2C=CC(C)C(C)C2O1 |
| InChI | InChI=1S/C17H28O2/c1-12-7-8-15-9-11-17(4,10-5-6-13(2)18)19-16(15)14(12)3/h7-8,12,14-16H,5-6,9-11H2,1-4H3 |
| InChIKey | IYDHLQYNCDRALL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|