C12H16F3NO4 — CID 91268014
[(3R,6R)-3-(4,4,4-trifluorobutanoylamino)-3,6-dihydro-2H-pyran-6-yl]methyl acetate (PubChem CID 91268014) has the molecular formula C12H16F3NO4 and a molecular weight of 295.26 g/mol. Its IUPAC name is [(3R,6R)-3-(4,4,4-trifluorobutanoylamino)-3,6-dihydro-2H-pyran-6-yl]methyl acetate.
| Compound Name | [(3R,6R)-3-(4,4,4-trifluorobutanoylamino)-3,6-dihydro-2H-pyran-6-yl]methyl acetate |
|---|---|
| PubChem CID | 91268014 |
| Molecular Formula | C12H16F3NO4 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | [(3R,6R)-3-(4,4,4-trifluorobutanoylamino)-3,6-dihydro-2H-pyran-6-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1C=C[C@@H](NC(=O)CCC(F)(F)F)CO1 |
| InChI | InChI=1S/C12H16F3NO4/c1-8(17)19-7-10-3-2-9(6-20-10)16-11(18)4-5-12(13,14)15/h2-3,9-10H,4-7H2,1H3,(H,16,18)/t9-,10-/m1/s1 |
| InChIKey | NYZGZHSBQFYGNA-NXEZZACHSA-N |
| XLogP | 1.33 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|