C13H19NO4 — CID 90687448
[(3R,6R)-3-(pent-4-enoylamino)-3,6-dihydro-2H-pyran-6-yl]methyl acetate (PubChem CID 90687448) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is [(3R,6R)-3-(pent-4-enoylamino)-3,6-dihydro-2H-pyran-6-yl]methyl acetate.
| Compound Name | [(3R,6R)-3-(pent-4-enoylamino)-3,6-dihydro-2H-pyran-6-yl]methyl acetate |
|---|---|
| PubChem CID | 90687448 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | [(3R,6R)-3-(pent-4-enoylamino)-3,6-dihydro-2H-pyran-6-yl]methyl acetate |
| SMILES | C=CCCC(=O)N[C@@H]1C=C[C@H](COC(C)=O)OC1 |
| InChI | InChI=1S/C13H19NO4/c1-3-4-5-13(16)14-11-6-7-12(18-8-11)9-17-10(2)15/h3,6-7,11-12H,1,4-5,8-9H2,2H3,(H,14,16)/t11-,12-/m1/s1 |
| InChIKey | FBKKLHYEQHFBSB-VXGBXAGGSA-N |
| XLogP | 0.96 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|