C28H52 — CID 91268284
[7,8,9,10-tetramethyl-4-(2-methylprop-2-enyl)-5-propyldodec-2-en-3-yl]cyclopentane (PubChem CID 91268284) has the molecular formula C28H52 and a molecular weight of 388.72 g/mol. Its IUPAC name is [7,8,9,10-tetramethyl-4-(2-methylprop-2-enyl)-5-propyldodec-2-en-3-yl]cyclopentane.
| Compound Name | [7,8,9,10-tetramethyl-4-(2-methylprop-2-enyl)-5-propyldodec-2-en-3-yl]cyclopentane |
|---|---|
| PubChem CID | 91268284 |
| Molecular Formula | C28H52 |
| Molecular Weight | 388.72 g/mol |
| Exact Mass | 388.41 |
| IUPAC Name | [7,8,9,10-tetramethyl-4-(2-methylprop-2-enyl)-5-propyldodec-2-en-3-yl]cyclopentane |
| SMILES | C=C(C)CC(C(=CC)C1CCCC1)C(CCC)CC(C)C(C)C(C)C(C)CC |
| InChI | InChI=1S/C28H52/c1-10-15-26(19-22(7)24(9)23(8)21(6)11-2)28(18-20(4)5)27(12-3)25-16-13-14-17-25/h12,21-26,28H,4,10-11,13-19H2,1-3,5-9H3 |
| InChIKey | PZSACGBZEXZEFF-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.72 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|