C18H19N3O3S — CID 91268915
ethyl 5-benzamido-2-(pent-1-en-3-ylideneamino)-1,3-thiazole-4-carboxylate (PubChem CID 91268915) has the molecular formula C18H19N3O3S and a molecular weight of 357.44 g/mol. Its IUPAC name is ethyl 5-benzamido-2-(pent-1-en-3-ylideneamino)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 5-benzamido-2-(pent-1-en-3-ylideneamino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 91268915 |
| Molecular Formula | C18H19N3O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | ethyl 5-benzamido-2-(pent-1-en-3-ylideneamino)-1,3-thiazole-4-carboxylate |
| SMILES | C=CC(CC)=Nc1nc(C(=O)OCC)c(NC(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C18H19N3O3S/c1-4-13(5-2)19-18-20-14(17(23)24-6-3)16(25-18)21-15(22)12-10-8-7-9-11-12/h4,7-11H,1,5-6H2,2-3H3,(H,21,22) |
| InChIKey | LAJFQISQYMHLMO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|