C13H13N3O2S — CID 174246138
5-benzamido-N,2-dimethyl-1,3-thiazole-4-carboxamide (PubChem CID 174246138) has the molecular formula C13H13N3O2S and a molecular weight of 275.33 g/mol. Its IUPAC name is 5-benzamido-N,2-dimethyl-1,3-thiazole-4-carboxamide.
| Compound Name | 5-benzamido-N,2-dimethyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 174246138 |
| Molecular Formula | C13H13N3O2S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 5-benzamido-N,2-dimethyl-1,3-thiazole-4-carboxamide |
| SMILES | CNC(=O)c1nc(C)sc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H13N3O2S/c1-8-15-10(12(18)14-2)13(19-8)16-11(17)9-6-4-3-5-7-9/h3-7H,1-2H3,(H,14,18)(H,16,17) |
| InChIKey | KSYLQKHQWDXVDV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |