C18H27NO2 — CID 91270066
(2S)-2-[(2,6-dimethyl-10-methylidenedodeca-2,6,11-trienylidene)amino]propanoic acid (PubChem CID 91270066) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is (2S)-2-[(2,6-dimethyl-10-methylidenedodeca-2,6,11-trienylidene)amino]propanoic acid.
| Compound Name | (2S)-2-[(2,6-dimethyl-10-methylidenedodeca-2,6,11-trienylidene)amino]propanoic acid |
|---|---|
| PubChem CID | 91270066 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | (2S)-2-[(2,6-dimethyl-10-methylidenedodeca-2,6,11-trienylidene)amino]propanoic acid |
| SMILES | C=CC(=C)CCC=C(C)CCC=C(C)/C=N/[C@@H](C)C(=O)O |
| InChI | InChI=1S/C18H27NO2/c1-6-14(2)9-7-10-15(3)11-8-12-16(4)13-19-17(5)18(20)21/h6,10,12-13,17H,1-2,7-9,11H2,3-5H3,(H,20,21)/b15-10?,16-12?,19-13+/t17-/m0/s1 |
| InChIKey | YCOPSAISKGOUOW-ZARCLKQKSA-N |
| XLogP | 4.73 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|