About cyclopentyl(dimethyl)phosphane;dimethyl-(2-propan-2-ylphenyl)phosphane;ethane
cyclopentyl(dimethyl)phosphane;dimethyl-(2-propan-2-ylphenyl)phosphane;ethane (PubChem CID 91270431) has the molecular formula C22H44P2
and a molecular weight of 370.54 g/mol. Its IUPAC name is cyclopentyl(dimethyl)phosphane;dimethyl-(2-propan-2-ylphenyl)phosphane;ethane.
Molecular Properties
| Compound Name | cyclopentyl(dimethyl)phosphane;dimethyl-(2-propan-2-ylphenyl)phosphane;ethane |
| PubChem CID | 91270431 |
| Molecular Formula | C22H44P2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | cyclopentyl(dimethyl)phosphane;dimethyl-(2-propan-2-ylphenyl)phosphane;ethane |
| SMILES | CC.CC.CC(C)c1ccccc1P(C)C.CP(C)C1CCCC1 |
| InChI | InChI=1S/C11H17P.C7H15P.2C2H6/c1-9(2)10-7-5-6-8-11(10)12(3)4;1-8(2)7-5-3-4-6-7;2*1-2/h5-9H,1-4H3;7H,3-6H2,1-2H3;2*1-2H3 |
| InChIKey | HIPFQDVTBMDSBL-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cyclopentyl(dimethyl)phosphane;dimethyl-(2-propan-2-ylphenyl)phosphane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl(dimethyl)phosphane;dimethyl-(2-propan-2-ylphenyl)phosphane;ethane?
The IUPAC name of cyclopentyl(dimethyl)phosphane;dimethyl-(2-propan-2-ylphenyl)phosphane;ethane (CID 91270431) is cyclopentyl(dimethyl)phosphane;dimethyl-(2-propan-2-ylphenyl)phosphane;ethane.
What is the SMILES notation for cyclopentyl(dimethyl)phosphane;dimethyl-(2-propan-2-ylphenyl)phosphane;ethane?
The canonical SMILES for cyclopentyl(dimethyl)phosphane;dimethyl-(2-propan-2-ylphenyl)phosphane;ethane is CC.CC.CC(C)c1ccccc1P(C)C.CP(C)C1CCCC1.
What is the InChIKey of cyclopentyl(dimethyl)phosphane;dimethyl-(2-propan-2-ylphenyl)phosphane;ethane?
The InChIKey is HIPFQDVTBMDSBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17P.C7H15P.2C2H6/c1-9(2)10-7-5-6-8-11(10)12(3)4;1-8(2)7-5-3-4-6-7;2*1-2/h5-9H,1-4H3;7H,3-6H2,1-2H3;2*1-2H3.
What are the key properties of cyclopentyl(dimethyl)phosphane;dimethyl-(2-propan-2-ylphenyl)phosphane;ethane?
cyclopentyl(dimethyl)phosphane;dimethyl-(2-propan-2-ylphenyl)phosphane;ethane has a molecular weight of 370.54 g/mol, XLogP of 7.90, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl(dimethyl)phosphane;dimethyl-(2-propan-2-ylphenyl)phosphane;ethane is sourced from PubChem (CID 91270431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).