C17H28P2 — CID 59893964
[2-[(1S)-1-(2-dimethylphosphanylcyclopentyl)ethyl]phenyl]-dimethylphosphane (PubChem CID 59893964) has the molecular formula C17H28P2 and a molecular weight of 294.36 g/mol. Its IUPAC name is [2-[(1S)-1-(2-dimethylphosphanylcyclopentyl)ethyl]phenyl]-dimethylphosphane.
| Compound Name | [2-[(1S)-1-(2-dimethylphosphanylcyclopentyl)ethyl]phenyl]-dimethylphosphane |
|---|---|
| PubChem CID | 59893964 |
| Molecular Formula | C17H28P2 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | [2-[(1S)-1-(2-dimethylphosphanylcyclopentyl)ethyl]phenyl]-dimethylphosphane |
| SMILES | C[C@H](c1ccccc1P(C)C)C1CCCC1P(C)C |
| InChI | InChI=1S/C17H28P2/c1-13(15-10-8-12-17(15)19(4)5)14-9-6-7-11-16(14)18(2)3/h6-7,9,11,13,15,17H,8,10,12H2,1-5H3/t13-,15?,17?/m1/s1 |
| InChIKey | ZLTAPRIPHKYTGW-BZOOQXSSSA-N |
| XLogP | 5.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|