C4H5F6NO2S — CID 91273390
1,1,1-trifluoro-2-[sulfino(2,2,2-trifluoroethyl)amino]ethane (PubChem CID 91273390) has the molecular formula C4H5F6NO2S and a molecular weight of 245.14 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-[sulfino(2,2,2-trifluoroethyl)amino]ethane.
| Compound Name | 1,1,1-trifluoro-2-[sulfino(2,2,2-trifluoroethyl)amino]ethane |
|---|---|
| PubChem CID | 91273390 |
| Molecular Formula | C4H5F6NO2S |
| Molecular Weight | 245.14 g/mol |
| Exact Mass | 244.99 |
| IUPAC Name | 1,1,1-trifluoro-2-[sulfino(2,2,2-trifluoroethyl)amino]ethane |
| SMILES | O=S(O)N(CC(F)(F)F)CC(F)(F)F |
| InChI | InChI=1S/C4H5F6NO2S/c5-3(6,7)1-11(14(12)13)2-4(8,9)10/h1-2H2,(H,12,13) |
| InChIKey | DXLHZHMEALPCMW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.14 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|