C3H6F3NO4S2 — CID 87186721
(2,2,2-trifluoroethylsulfonylamino)methanesulfinic acid (PubChem CID 87186721) has the molecular formula C3H6F3NO4S2 and a molecular weight of 241.21 g/mol. Its IUPAC name is (2,2,2-trifluoroethylsulfonylamino)methanesulfinic acid.
| Compound Name | (2,2,2-trifluoroethylsulfonylamino)methanesulfinic acid |
|---|---|
| PubChem CID | 87186721 |
| Molecular Formula | C3H6F3NO4S2 |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 240.97 |
| IUPAC Name | (2,2,2-trifluoroethylsulfonylamino)methanesulfinic acid |
| SMILES | O=S(O)CNS(=O)(=O)CC(F)(F)F |
| InChI | InChI=1S/C3H6F3NO4S2/c4-3(5,6)1-13(10,11)7-2-12(8)9/h7H,1-2H2,(H,8,9) |
| InChIKey | FBMNSGPGSPNQBS-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|