C8H13F3INO4S — CID 131966890
(2,2,2-trifluoroethylsulfonylamino)methyl 2-iodo-2-methylbutanoate (PubChem CID 131966890) has the molecular formula C8H13F3INO4S and a molecular weight of 403.16 g/mol. Its IUPAC name is (2,2,2-trifluoroethylsulfonylamino)methyl 2-iodo-2-methylbutanoate.
| Compound Name | (2,2,2-trifluoroethylsulfonylamino)methyl 2-iodo-2-methylbutanoate |
|---|---|
| PubChem CID | 131966890 |
| Molecular Formula | C8H13F3INO4S |
| Molecular Weight | 403.16 g/mol |
| Exact Mass | 402.96 |
| IUPAC Name | (2,2,2-trifluoroethylsulfonylamino)methyl 2-iodo-2-methylbutanoate |
| SMILES | CCC(C)(I)C(=O)OCNS(=O)(=O)CC(F)(F)F |
| InChI | InChI=1S/C8H13F3INO4S/c1-3-7(2,12)6(14)17-5-13-18(15,16)4-8(9,10)11/h13H,3-5H2,1-2H3 |
| InChIKey | ZBTDQYFGMZIUGO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.16 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|