C19H16N4O2 — CID 91276860
3-(2-cyanoethyl)-6-methoxy-4-pyridin-3-ylisoquinoline-1-carboxamide (PubChem CID 91276860) has the molecular formula C19H16N4O2 and a molecular weight of 332.36 g/mol. Its IUPAC name is 3-(2-cyanoethyl)-6-methoxy-4-pyridin-3-ylisoquinoline-1-carboxamide.
| Compound Name | 3-(2-cyanoethyl)-6-methoxy-4-pyridin-3-ylisoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 91276860 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 3-(2-cyanoethyl)-6-methoxy-4-pyridin-3-ylisoquinoline-1-carboxamide |
| SMILES | COc1ccc2c(C(N)=O)nc(CCC#N)c(-c3cccnc3)c2c1 |
| InChI | InChI=1S/C19H16N4O2/c1-25-13-6-7-14-15(10-13)17(12-4-3-9-22-11-12)16(5-2-8-20)23-18(14)19(21)24/h3-4,6-7,9-11H,2,5H2,1H3,(H2,21,24) |
| InChIKey | ARQKUSVNQLFWCU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 101.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |