About ethane;methyl-methylimino-bis(3-methylphenoxy)-λ5-phosphane
ethane;methyl-methylimino-bis(3-methylphenoxy)-λ5-phosphane (PubChem CID 91278788) has the molecular formula C20H32NO2P
and a molecular weight of 349.46 g/mol. Its IUPAC name is ethane;methyl-methylimino-bis(3-methylphenoxy)-λ5-phosphane.
Molecular Properties
| Compound Name | ethane;methyl-methylimino-bis(3-methylphenoxy)-λ5-phosphane |
| PubChem CID | 91278788 |
| Molecular Formula | C20H32NO2P |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | ethane;methyl-methylimino-bis(3-methylphenoxy)-λ5-phosphane |
| SMILES | CC.CC.CN=P(C)(Oc1cccc(C)c1)Oc1cccc(C)c1 |
| InChI | InChI=1S/C16H20NO2P.2C2H6/c1-13-7-5-9-15(11-13)18-20(4,17-3)19-16-10-6-8-14(2)12-16;2*1-2/h5-12H,1-4H3;2*1-2H3 |
| InChIKey | WLWXZFPVQYPACA-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethane;methyl-methylimino-bis(3-methylphenoxy)-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl-methylimino-bis(3-methylphenoxy)-λ5-phosphane?
The IUPAC name of ethane;methyl-methylimino-bis(3-methylphenoxy)-λ5-phosphane (CID 91278788) is ethane;methyl-methylimino-bis(3-methylphenoxy)-λ5-phosphane.
What is the SMILES notation for ethane;methyl-methylimino-bis(3-methylphenoxy)-λ5-phosphane?
The canonical SMILES for ethane;methyl-methylimino-bis(3-methylphenoxy)-λ5-phosphane is CC.CC.CN=P(C)(Oc1cccc(C)c1)Oc1cccc(C)c1.
What is the InChIKey of ethane;methyl-methylimino-bis(3-methylphenoxy)-λ5-phosphane?
The InChIKey is WLWXZFPVQYPACA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20NO2P.2C2H6/c1-13-7-5-9-15(11-13)18-20(4,17-3)19-16-10-6-8-14(2)12-16;2*1-2/h5-12H,1-4H3;2*1-2H3.
What are the key properties of ethane;methyl-methylimino-bis(3-methylphenoxy)-λ5-phosphane?
ethane;methyl-methylimino-bis(3-methylphenoxy)-λ5-phosphane has a molecular weight of 349.46 g/mol, XLogP of 7.10, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl-methylimino-bis(3-methylphenoxy)-λ5-phosphane is sourced from PubChem (CID 91278788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).