C7H9N2O4S- — CID 91287062
[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl] sulfite (PubChem CID 91287062) has the molecular formula C7H9N2O4S- and a molecular weight of 217.23 g/mol. Its IUPAC name is [2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl] sulfite.
| Compound Name | [2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl] sulfite |
|---|---|
| PubChem CID | 91287062 |
| Molecular Formula | C7H9N2O4S- |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | [2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl] sulfite |
| SMILES | N#CC1CCCN1C(=O)COS(=O)[O-] |
| InChI | InChI=1S/C7H10N2O4S/c8-4-6-2-1-3-9(6)7(10)5-13-14(11)12/h6H,1-3,5H2,(H,11,12)/p-1 |
| InChIKey | CBLAZYAIVVKWFT-UHFFFAOYSA-M |
| XLogP | -0.69 |
| TPSA | 93.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|