C27H32F6N2O3 — CID 91287933
1-[4-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-2-prop-1-enylphenyl]-4-(2-phenylmethoxyethyl)piperazine (PubChem CID 91287933) has the molecular formula C27H32F6N2O3 and a molecular weight of 546.55 g/mol. Its IUPAC name is 1-[4-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-2-prop-1-enylphenyl]-4-(2-phenylmethoxyethyl)piperazine.
| Compound Name | 1-[4-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-2-prop-1-enylphenyl]-4-(2-phenylmethoxyethyl)piperazine |
|---|---|
| PubChem CID | 91287933 |
| Molecular Formula | C27H32F6N2O3 |
| Molecular Weight | 546.55 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | 1-[4-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-2-prop-1-enylphenyl]-4-(2-phenylmethoxyethyl)piperazine |
| SMILES | CC=Cc1cc(C(OCOC)(C(F)(F)F)C(F)(F)F)ccc1N1CCN(CCOCc2ccccc2)CC1 |
| InChI | InChI=1S/C27H32F6N2O3/c1-3-7-22-18-23(25(26(28,29)30,27(31,32)33)38-20-36-2)10-11-24(22)35-14-12-34(13-15-35)16-17-37-19-21-8-5-4-6-9-21/h3-11,18H,12-17,19-20H2,1-2H3 |
| InChIKey | HNJDSVQWIJGYFT-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.55 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|