C32H41ClN2O4 — CID 91288082
tert-butyl N-[4-[4-[[3-(2-chloropropan-2-yl)-5-phenylmethoxyphenyl]methylamino]-3-hydroxyphenyl]butan-2-yl]carbamate (PubChem CID 91288082) has the molecular formula C32H41ClN2O4 and a molecular weight of 553.14 g/mol. Its IUPAC name is tert-butyl N-[4-[4-[[3-(2-chloropropan-2-yl)-5-phenylmethoxyphenyl]methylamino]-3-hydroxyphenyl]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[4-[[3-(2-chloropropan-2-yl)-5-phenylmethoxyphenyl]methylamino]-3-hydroxyphenyl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 91288082 |
| Molecular Formula | C32H41ClN2O4 |
| Molecular Weight | 553.14 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | tert-butyl N-[4-[4-[[3-(2-chloropropan-2-yl)-5-phenylmethoxyphenyl]methylamino]-3-hydroxyphenyl]butan-2-yl]carbamate |
| SMILES | CC(CCc1ccc(NCc2cc(OCc3ccccc3)cc(C(C)(C)Cl)c2)c(O)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H41ClN2O4/c1-22(35-30(37)39-31(2,3)4)12-13-23-14-15-28(29(36)18-23)34-20-25-16-26(32(5,6)33)19-27(17-25)38-21-24-10-8-7-9-11-24/h7-11,14-19,22,34,36H,12-13,20-21H2,1-6H3,(H,35,37) |
| InChIKey | RYTTYLRPUHLDON-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.14 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|