C21H28N2O4 — CID 68726457
4-[3-hydroxy-4-[[3-(2-hydroxypropan-2-yl)phenyl]methylamino]phenyl]butan-2-ylcarbamic acid (PubChem CID 68726457) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is 4-[3-hydroxy-4-[[3-(2-hydroxypropan-2-yl)phenyl]methylamino]phenyl]butan-2-ylcarbamic acid.
| Compound Name | 4-[3-hydroxy-4-[[3-(2-hydroxypropan-2-yl)phenyl]methylamino]phenyl]butan-2-ylcarbamic acid |
|---|---|
| PubChem CID | 68726457 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 4-[3-hydroxy-4-[[3-(2-hydroxypropan-2-yl)phenyl]methylamino]phenyl]butan-2-ylcarbamic acid |
| SMILES | CC(CCc1ccc(NCc2cccc(C(C)(C)O)c2)c(O)c1)NC(=O)O |
| InChI | InChI=1S/C21H28N2O4/c1-14(23-20(25)26)7-8-15-9-10-18(19(24)12-15)22-13-16-5-4-6-17(11-16)21(2,3)27/h4-6,9-12,14,22-24,27H,7-8,13H2,1-3H3,(H,25,26) |
| InChIKey | GSJIPOHYFYECNN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|