C22H31N3O3 — CID 68727684
4-[4-[[3-(diethylamino)phenyl]methylamino]-3-hydroxyphenyl]butan-2-ylcarbamic acid (PubChem CID 68727684) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is 4-[4-[[3-(diethylamino)phenyl]methylamino]-3-hydroxyphenyl]butan-2-ylcarbamic acid.
| Compound Name | 4-[4-[[3-(diethylamino)phenyl]methylamino]-3-hydroxyphenyl]butan-2-ylcarbamic acid |
|---|---|
| PubChem CID | 68727684 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 4-[4-[[3-(diethylamino)phenyl]methylamino]-3-hydroxyphenyl]butan-2-ylcarbamic acid |
| SMILES | CCN(CC)c1cccc(CNc2ccc(CCC(C)NC(=O)O)cc2O)c1 |
| InChI | InChI=1S/C22H31N3O3/c1-4-25(5-2)19-8-6-7-18(13-19)15-23-20-12-11-17(14-21(20)26)10-9-16(3)24-22(27)28/h6-8,11-14,16,23-24,26H,4-5,9-10,15H2,1-3H3,(H,27,28) |
| InChIKey | FAQZTNOLPPSYCA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|