C20H27N3O3 — CID 68732253
[(2S)-butan-2-yl]-[4-[[3-(dimethylamino)phenyl]methylamino]-3-hydroxyphenyl]carbamic acid (PubChem CID 68732253) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is [(2S)-butan-2-yl]-[4-[[3-(dimethylamino)phenyl]methylamino]-3-hydroxyphenyl]carbamic acid.
| Compound Name | [(2S)-butan-2-yl]-[4-[[3-(dimethylamino)phenyl]methylamino]-3-hydroxyphenyl]carbamic acid |
|---|---|
| PubChem CID | 68732253 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | [(2S)-butan-2-yl]-[4-[[3-(dimethylamino)phenyl]methylamino]-3-hydroxyphenyl]carbamic acid |
| SMILES | CC[C@H](C)N(C(=O)O)c1ccc(NCc2cccc(N(C)C)c2)c(O)c1 |
| InChI | InChI=1S/C20H27N3O3/c1-5-14(2)23(20(25)26)17-9-10-18(19(24)12-17)21-13-15-7-6-8-16(11-15)22(3)4/h6-12,14,21,24H,5,13H2,1-4H3,(H,25,26)/t14-/m0/s1 |
| InChIKey | HTWGCMSFDHFETR-AWEZNQCLSA-N |
| XLogP | 4.35 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|