C23H31N3O4 — CID 68727259
[4-[(3-acetamido-5-propan-2-ylphenyl)methylamino]-3-hydroxyphenyl]-[(2S)-butan-2-yl]carbamic acid (PubChem CID 68727259) has the molecular formula C23H31N3O4 and a molecular weight of 413.52 g/mol. Its IUPAC name is [4-[(3-acetamido-5-propan-2-ylphenyl)methylamino]-3-hydroxyphenyl]-[(2S)-butan-2-yl]carbamic acid.
| Compound Name | [4-[(3-acetamido-5-propan-2-ylphenyl)methylamino]-3-hydroxyphenyl]-[(2S)-butan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 68727259 |
| Molecular Formula | C23H31N3O4 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | [4-[(3-acetamido-5-propan-2-ylphenyl)methylamino]-3-hydroxyphenyl]-[(2S)-butan-2-yl]carbamic acid |
| SMILES | CC[C@H](C)N(C(=O)O)c1ccc(NCc2cc(NC(C)=O)cc(C(C)C)c2)c(O)c1 |
| InChI | InChI=1S/C23H31N3O4/c1-6-15(4)26(23(29)30)20-7-8-21(22(28)12-20)24-13-17-9-18(14(2)3)11-19(10-17)25-16(5)27/h7-12,14-15,24,28H,6,13H2,1-5H3,(H,25,27)(H,29,30)/t15-/m0/s1 |
| InChIKey | UGLSWSXBLSKABK-HNNXBMFYSA-N |
| XLogP | 5.37 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|