C21H27ClN2O4 — CID 68725196
[(2S)-butan-2-yl]-[4-[[3-(2-chloropropan-2-yl)-5-hydroxyphenyl]methylamino]-3-hydroxyphenyl]carbamic acid (PubChem CID 68725196) has the molecular formula C21H27ClN2O4 and a molecular weight of 406.91 g/mol. Its IUPAC name is [(2S)-butan-2-yl]-[4-[[3-(2-chloropropan-2-yl)-5-hydroxyphenyl]methylamino]-3-hydroxyphenyl]carbamic acid.
| Compound Name | [(2S)-butan-2-yl]-[4-[[3-(2-chloropropan-2-yl)-5-hydroxyphenyl]methylamino]-3-hydroxyphenyl]carbamic acid |
|---|---|
| PubChem CID | 68725196 |
| Molecular Formula | C21H27ClN2O4 |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | [(2S)-butan-2-yl]-[4-[[3-(2-chloropropan-2-yl)-5-hydroxyphenyl]methylamino]-3-hydroxyphenyl]carbamic acid |
| SMILES | CC[C@H](C)N(C(=O)O)c1ccc(NCc2cc(O)cc(C(C)(C)Cl)c2)c(O)c1 |
| InChI | InChI=1S/C21H27ClN2O4/c1-5-13(2)24(20(27)28)16-6-7-18(19(26)11-16)23-12-14-8-15(21(3,4)22)10-17(25)9-14/h6-11,13,23,25-26H,5,12H2,1-4H3,(H,27,28)/t13-/m0/s1 |
| InChIKey | FYAURYHXVQFWJW-ZDUSSCGKSA-N |
| XLogP | 5.47 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|